C21H37N2O9P — CID 178052116
[3-[5-[formyl-[(Z)-3-(methylamino)-3-oxoprop-1-enyl]amino]oxolan-2-yl]butyl-(methoxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropanoate (PubChem CID 178052116) has the molecular formula C21H37N2O9P and a molecular weight of 492.51 g/mol. Its IUPAC name is [3-[5-[formyl-[(Z)-3-(methylamino)-3-oxoprop-1-enyl]amino]oxolan-2-yl]butyl-(methoxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropanoate.
| Compound Name | [3-[5-[formyl-[(Z)-3-(methylamino)-3-oxoprop-1-enyl]amino]oxolan-2-yl]butyl-(methoxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 178052116 |
| Molecular Formula | C21H37N2O9P |
| Molecular Weight | 492.51 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | [3-[5-[formyl-[(Z)-3-(methylamino)-3-oxoprop-1-enyl]amino]oxolan-2-yl]butyl-(methoxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropanoate |
| SMILES | CNC(=O)/C=C\N(C=O)C1CCC(C(C)CCP(=O)(OCOC)OCOC(=O)C(C)(C)C)O1 |
| InChI | InChI=1S/C21H37N2O9P/c1-16(17-7-8-19(32-17)23(13-24)11-9-18(25)22-5)10-12-33(27,30-14-28-6)31-15-29-20(26)21(2,3)4/h9,11,13,16-17,19H,7-8,10,12,14-15H2,1-6H3,(H,22,25)/b11-9- |
| InChIKey | ZRADUJYFJHTCDE-LUAWRHEFSA-N |
| XLogP | 2.61 |
| TPSA | 129.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.51 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|