About 3-[(2-fluoro-2-methylcyclopropyl)methyl]-N,N-dipropylbut-3-enamide
3-[(2-fluoro-2-methylcyclopropyl)methyl]-N,N-dipropylbut-3-enamide (PubChem CID 178053917) has the molecular formula C15H26FNO
and a molecular weight of 255.38 g/mol. Its IUPAC name is 3-[(2-fluoro-2-methylcyclopropyl)methyl]-N,N-dipropylbut-3-enamide.
Molecular Properties
| Compound Name | 3-[(2-fluoro-2-methylcyclopropyl)methyl]-N,N-dipropylbut-3-enamide |
| PubChem CID | 178053917 |
| Molecular Formula | C15H26FNO |
| Molecular Weight | 255.38 g/mol |
| Exact Mass | 255.20 |
| IUPAC Name | 3-[(2-fluoro-2-methylcyclopropyl)methyl]-N,N-dipropylbut-3-enamide |
| SMILES | C=C(CC(=O)N(CCC)CCC)CC1CC1(C)F |
| InChI | InChI=1S/C15H26FNO/c1-5-7-17(8-6-2)14(18)10-12(3)9-13-11-15(13,4)16/h13H,3,5-11H2,1-2,4H3 |
| InChIKey | ZOTPYNONARHETA-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.38 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2-fluoro-2-methylcyclopropyl)methyl]-N,N-dipropylbut-3-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2-fluoro-2-methylcyclopropyl)methyl]-N,N-dipropylbut-3-enamide?
The IUPAC name of 3-[(2-fluoro-2-methylcyclopropyl)methyl]-N,N-dipropylbut-3-enamide (CID 178053917) is 3-[(2-fluoro-2-methylcyclopropyl)methyl]-N,N-dipropylbut-3-enamide.
What is the SMILES notation for 3-[(2-fluoro-2-methylcyclopropyl)methyl]-N,N-dipropylbut-3-enamide?
The canonical SMILES for 3-[(2-fluoro-2-methylcyclopropyl)methyl]-N,N-dipropylbut-3-enamide is C=C(CC(=O)N(CCC)CCC)CC1CC1(C)F.
What is the InChIKey of 3-[(2-fluoro-2-methylcyclopropyl)methyl]-N,N-dipropylbut-3-enamide?
The InChIKey is ZOTPYNONARHETA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26FNO/c1-5-7-17(8-6-2)14(18)10-12(3)9-13-11-15(13,4)16/h13H,3,5-11H2,1-2,4H3.
What are the key properties of 3-[(2-fluoro-2-methylcyclopropyl)methyl]-N,N-dipropylbut-3-enamide?
3-[(2-fluoro-2-methylcyclopropyl)methyl]-N,N-dipropylbut-3-enamide has a molecular weight of 255.38 g/mol, XLogP of 3.72, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-fluoro-2-methylcyclopropyl)methyl]-N,N-dipropylbut-3-enamide is sourced from PubChem (CID 178053917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).