C23H24Cl2F3N5O3 — CID 178053924
tert-butyl N-[2-[2-[(1R)-1-[(2,6-dichloropyrido[3,4-d]pyrimidin-4-yl)amino]ethyl]-6-(trifluoromethyl)phenoxy]ethyl]carbamate (PubChem CID 178053924) has the molecular formula C23H24Cl2F3N5O3 and a molecular weight of 546.38 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[(1R)-1-[(2,6-dichloropyrido[3,4-d]pyrimidin-4-yl)amino]ethyl]-6-(trifluoromethyl)phenoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[(1R)-1-[(2,6-dichloropyrido[3,4-d]pyrimidin-4-yl)amino]ethyl]-6-(trifluoromethyl)phenoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 178053924 |
| Molecular Formula | C23H24Cl2F3N5O3 |
| Molecular Weight | 546.38 g/mol |
| Exact Mass | 545.12 |
| IUPAC Name | tert-butyl N-[2-[2-[(1R)-1-[(2,6-dichloropyrido[3,4-d]pyrimidin-4-yl)amino]ethyl]-6-(trifluoromethyl)phenoxy]ethyl]carbamate |
| SMILES | C[C@@H](Nc1nc(Cl)nc2cnc(Cl)cc12)c1cccc(C(F)(F)F)c1OCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H24Cl2F3N5O3/c1-12(31-19-14-10-17(24)30-11-16(14)32-20(25)33-19)13-6-5-7-15(23(26,27)28)18(13)35-9-8-29-21(34)36-22(2,3)4/h5-7,10-12H,8-9H2,1-4H3,(H,29,34)(H,31,32,33)/t12-/m1/s1 |
| InChIKey | ZRFZOQNSGMYCIU-GFCCVEGCSA-N |
| XLogP | 6.43 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.38 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|