About CID 178054253
CID 178054253 (PubChem CID 178054253) has the molecular formula C25H28N2OSi-
and a molecular weight of 400.60 g/mol.
Molecular Properties
| Compound Name | CID 178054253 |
| PubChem CID | 178054253 |
| Molecular Formula | C25H28N2OSi- |
| Molecular Weight | 400.60 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | — |
| SMILES | CC(C)(C)[Si-](OCCNc1ccc(C#N)cc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H28N2OSi/c1-25(2,3)29(23-10-6-4-7-11-23,24-12-8-5-9-13-24)28-19-18-27-22-16-14-21(20-26)15-17-22/h4-17,27H,18-19H2,1-3H3/q-1 |
| InChIKey | QYFISFLEJPZRER-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.60 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 178054253 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 178054253?
The IUPAC name of CID 178054253 (CID 178054253) is not available.
What is the SMILES notation for CID 178054253?
The canonical SMILES for CID 178054253 is CC(C)(C)[Si-](OCCNc1ccc(C#N)cc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of CID 178054253?
The InChIKey is QYFISFLEJPZRER-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H28N2OSi/c1-25(2,3)29(23-10-6-4-7-11-23,24-12-8-5-9-13-24)28-19-18-27-22-16-14-21(20-26)15-17-22/h4-17,27H,18-19H2,1-3H3/q-1.
What are the key properties of CID 178054253?
CID 178054253 has a molecular weight of 400.60 g/mol, XLogP of 4.55, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 178054253 is sourced from PubChem (CID 178054253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).