C25H16Cl2F8N2O5S — CID 178055199
6-[4-[1-(3,4-dichlorophenyl)-2,2-difluoroethoxy]-3-(trifluoromethoxy)phenyl]-5-methyl-1-[(2R)-3,3,3-trifluoro-2-hydroxypropyl]thieno[2,3-d]pyrimidine-2,4-dione (PubChem CID 178055199) has the molecular formula C25H16Cl2F8N2O5S and a molecular weight of 679.37 g/mol. Its IUPAC name is 6-[4-[1-(3,4-dichlorophenyl)-2,2-difluoroethoxy]-3-(trifluoromethoxy)phenyl]-5-methyl-1-[(2R)-3,3,3-trifluoro-2-hydroxypropyl]thieno[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 6-[4-[1-(3,4-dichlorophenyl)-2,2-difluoroethoxy]-3-(trifluoromethoxy)phenyl]-5-methyl-1-[(2R)-3,3,3-trifluoro-2-hydroxypropyl]thieno[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 178055199 |
| Molecular Formula | C25H16Cl2F8N2O5S |
| Molecular Weight | 679.37 g/mol |
| Exact Mass | 678.00 |
| IUPAC Name | 6-[4-[1-(3,4-dichlorophenyl)-2,2-difluoroethoxy]-3-(trifluoromethoxy)phenyl]-5-methyl-1-[(2R)-3,3,3-trifluoro-2-hydroxypropyl]thieno[2,3-d]pyrimidine-2,4-dione |
| SMILES | Cc1c(-c2ccc(OC(c3ccc(Cl)c(Cl)c3)C(F)F)c(OC(F)(F)F)c2)sc2c1c(=O)[nH]c(=O)n2C[C@@H](O)C(F)(F)F |
| InChI | InChI=1S/C25H16Cl2F8N2O5S/c1-9-17-21(39)36-23(40)37(8-16(38)24(30,31)32)22(17)43-19(9)11-3-5-14(15(7-11)42-25(33,34)35)41-18(20(28)29)10-2-4-12(26)13(27)6-10/h2-7,16,18,20,38H,8H2,1H3,(H,36,39,40)/t16-,18?/m1/s1 |
| InChIKey | XSEHJDOKYUNLFF-PYUWXLGESA-N |
| XLogP | 7.24 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.37 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |