C47H86N2O10 — CID 178056619
4-[2,3-bis[[8-(dihexylamino)-8-oxooctanoyl]oxy]propoxy]-4-oxobutanoic acid (PubChem CID 178056619) has the molecular formula C47H86N2O10 and a molecular weight of 839.21 g/mol. Its IUPAC name is 4-[2,3-bis[[8-(dihexylamino)-8-oxooctanoyl]oxy]propoxy]-4-oxobutanoic acid.
| Compound Name | 4-[2,3-bis[[8-(dihexylamino)-8-oxooctanoyl]oxy]propoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 178056619 |
| Molecular Formula | C47H86N2O10 |
| Molecular Weight | 839.21 g/mol |
| Exact Mass | 838.63 |
| IUPAC Name | 4-[2,3-bis[[8-(dihexylamino)-8-oxooctanoyl]oxy]propoxy]-4-oxobutanoic acid |
| SMILES | CCCCCCN(CCCCCC)C(=O)CCCCCCC(=O)OCC(COC(=O)CCC(=O)O)OC(=O)CCCCCCC(=O)N(CCCCCC)CCCCCC |
| InChI | InChI=1S/C47H86N2O10/c1-5-9-13-25-35-48(36-26-14-10-6-2)42(50)29-21-17-19-23-31-45(54)57-39-41(40-58-46(55)34-33-44(52)53)59-47(56)32-24-20-18-22-30-43(51)49(37-27-15-11-7-3)38-28-16-12-8-4/h41H,5-40H2,1-4H3,(H,52,53) |
| InChIKey | ZDZDOBVHRRRNQG-UHFFFAOYSA-N |
| XLogP | 10.51 |
| TPSA | 156.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 839.21 |
| LogP ≤ 5 | 10.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|