C13H18FNO — CID 178056915
N-[(3Z,5Z)-3-fluoro-5-propan-2-ylhepta-1,3,5-trien-4-yl]prop-2-enamide (PubChem CID 178056915) has the molecular formula C13H18FNO and a molecular weight of 223.29 g/mol. Its IUPAC name is N-[(3Z,5Z)-3-fluoro-5-propan-2-ylhepta-1,3,5-trien-4-yl]prop-2-enamide.
| Compound Name | N-[(3Z,5Z)-3-fluoro-5-propan-2-ylhepta-1,3,5-trien-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 178056915 |
| Molecular Formula | C13H18FNO |
| Molecular Weight | 223.29 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | N-[(3Z,5Z)-3-fluoro-5-propan-2-ylhepta-1,3,5-trien-4-yl]prop-2-enamide |
| SMILES | C=CC(=O)NC(/C(=C\C)C(C)C)=C(\F)C=C |
| InChI | InChI=1S/C13H18FNO/c1-6-10(9(4)5)13(11(14)7-2)15-12(16)8-3/h6-9H,2-3H2,1,4-5H3,(H,15,16)/b10-6-,13-11- |
| InChIKey | ICXWLMSXYJHFRB-YGFXUZJOSA-N |
| XLogP | 3.26 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.29 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|