C28H40F2N2O2 — CID 178056928
ethane;2-fluoro-N-(3-propan-2-ylphenyl)prop-2-enamide;N-(3-fluoro-2-propan-2-ylphenyl)prop-2-enamide (PubChem CID 178056928) has the molecular formula C28H40F2N2O2 and a molecular weight of 474.64 g/mol. Its IUPAC name is ethane;2-fluoro-N-(3-propan-2-ylphenyl)prop-2-enamide;N-(3-fluoro-2-propan-2-ylphenyl)prop-2-enamide.
| Compound Name | ethane;2-fluoro-N-(3-propan-2-ylphenyl)prop-2-enamide;N-(3-fluoro-2-propan-2-ylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 178056928 |
| Molecular Formula | C28H40F2N2O2 |
| Molecular Weight | 474.64 g/mol |
| Exact Mass | 474.31 |
| IUPAC Name | ethane;2-fluoro-N-(3-propan-2-ylphenyl)prop-2-enamide;N-(3-fluoro-2-propan-2-ylphenyl)prop-2-enamide |
| SMILES | C=C(F)C(=O)Nc1cccc(C(C)C)c1.C=CC(=O)Nc1cccc(F)c1C(C)C.CC.CC |
| InChI | InChI=1S/2C12H14FNO.2C2H6/c1-8(2)10-5-4-6-11(7-10)14-12(15)9(3)13;1-4-11(15)14-10-7-5-6-9(13)12(10)8(2)3;2*1-2/h4-8H,3H2,1-2H3,(H,14,15);4-8H,1H2,2-3H3,(H,14,15);2*1-2H3 |
| InChIKey | MTLUQXUWRKPUSO-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.64 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|