About 2,3,5,6,7,8-hexahydroimidazo[1,2-a]pyrazin-3-amine
2,3,5,6,7,8-hexahydroimidazo[1,2-a]pyrazin-3-amine (PubChem CID 178057942) has the molecular formula C6H12N4
and a molecular weight of 140.19 g/mol. Its IUPAC name is 2,3,5,6,7,8-hexahydroimidazo[1,2-a]pyrazin-3-amine.
Analyze 2,3,5,6,7,8-hexahydroimidazo[1,2-a]pyrazin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,5,6,7,8-hexahydroimidazo[1,2-a]pyrazin-3-amine?
The IUPAC name of 2,3,5,6,7,8-hexahydroimidazo[1,2-a]pyrazin-3-amine (CID 178057942) is 2,3,5,6,7,8-hexahydroimidazo[1,2-a]pyrazin-3-amine.
What is the SMILES notation for 2,3,5,6,7,8-hexahydroimidazo[1,2-a]pyrazin-3-amine?
The canonical SMILES for 2,3,5,6,7,8-hexahydroimidazo[1,2-a]pyrazin-3-amine is NC1CN=C2CNCCN21.
What is the InChIKey of 2,3,5,6,7,8-hexahydroimidazo[1,2-a]pyrazin-3-amine?
The InChIKey is VJIJLNNKLXURDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N4/c7-5-3-9-6-4-8-1-2-10(5)6/h5,8H,1-4,7H2.
What are the key properties of 2,3,5,6,7,8-hexahydroimidazo[1,2-a]pyrazin-3-amine?
2,3,5,6,7,8-hexahydroimidazo[1,2-a]pyrazin-3-amine has a molecular weight of 140.19 g/mol, XLogP of -1.41, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,5,6,7,8-hexahydroimidazo[1,2-a]pyrazin-3-amine is sourced from PubChem (CID 178057942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).