About (5Z,7E)-7-fluoro-2-methyl-4-propan-2-ylidenenona-5,7-dien-2-amine
(5Z,7E)-7-fluoro-2-methyl-4-propan-2-ylidenenona-5,7-dien-2-amine (PubChem CID 178058501) has the molecular formula C13H22FN
and a molecular weight of 211.32 g/mol. Its IUPAC name is (5Z,7E)-7-fluoro-2-methyl-4-propan-2-ylidenenona-5,7-dien-2-amine.
Molecular Properties
| Compound Name | (5Z,7E)-7-fluoro-2-methyl-4-propan-2-ylidenenona-5,7-dien-2-amine |
| PubChem CID | 178058501 |
| Molecular Formula | C13H22FN |
| Molecular Weight | 211.32 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | (5Z,7E)-7-fluoro-2-methyl-4-propan-2-ylidenenona-5,7-dien-2-amine |
| SMILES | C/C=C(F)\C=C/C(CC(C)(C)N)=C(C)C |
| InChI | InChI=1S/C13H22FN/c1-6-12(14)8-7-11(10(2)3)9-13(4,5)15/h6-8H,9,15H2,1-5H3/b8-7-,12-6+ |
| InChIKey | XINODYVKFMYEIC-HRZQEMGZSA-N |
| XLogP | 3.88 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.32 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (5Z,7E)-7-fluoro-2-methyl-4-propan-2-ylidenenona-5,7-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z,7E)-7-fluoro-2-methyl-4-propan-2-ylidenenona-5,7-dien-2-amine?
The IUPAC name of (5Z,7E)-7-fluoro-2-methyl-4-propan-2-ylidenenona-5,7-dien-2-amine (CID 178058501) is (5Z,7E)-7-fluoro-2-methyl-4-propan-2-ylidenenona-5,7-dien-2-amine.
What is the SMILES notation for (5Z,7E)-7-fluoro-2-methyl-4-propan-2-ylidenenona-5,7-dien-2-amine?
The canonical SMILES for (5Z,7E)-7-fluoro-2-methyl-4-propan-2-ylidenenona-5,7-dien-2-amine is C/C=C(F)\C=C/C(CC(C)(C)N)=C(C)C.
What is the InChIKey of (5Z,7E)-7-fluoro-2-methyl-4-propan-2-ylidenenona-5,7-dien-2-amine?
The InChIKey is XINODYVKFMYEIC-HRZQEMGZSA-N. The full InChI is InChI=1S/C13H22FN/c1-6-12(14)8-7-11(10(2)3)9-13(4,5)15/h6-8H,9,15H2,1-5H3/b8-7-,12-6+.
What are the key properties of (5Z,7E)-7-fluoro-2-methyl-4-propan-2-ylidenenona-5,7-dien-2-amine?
(5Z,7E)-7-fluoro-2-methyl-4-propan-2-ylidenenona-5,7-dien-2-amine has a molecular weight of 211.32 g/mol, XLogP of 3.88, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z,7E)-7-fluoro-2-methyl-4-propan-2-ylidenenona-5,7-dien-2-amine is sourced from PubChem (CID 178058501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).