C24H30F6N4OS — CID 178058528
3-[1-(difluoromethyl)-2H-azet-3-yl]-N-[1-[5-[(2E)-2-fluoro-6-methyl-1-oxohepta-2,4-dien-4-yl]-3-(trifluoromethyl)pyrazol-1-yl]-2-methylpropan-2-yl]-2-methylpropanethioamide (PubChem CID 178058528) has the molecular formula C24H30F6N4OS and a molecular weight of 536.59 g/mol. Its IUPAC name is 3-[1-(difluoromethyl)-2H-azet-3-yl]-N-[1-[5-[(2E)-2-fluoro-6-methyl-1-oxohepta-2,4-dien-4-yl]-3-(trifluoromethyl)pyrazol-1-yl]-2-methylpropan-2-yl]-2-methylpropanethioamide.
| Compound Name | 3-[1-(difluoromethyl)-2H-azet-3-yl]-N-[1-[5-[(2E)-2-fluoro-6-methyl-1-oxohepta-2,4-dien-4-yl]-3-(trifluoromethyl)pyrazol-1-yl]-2-methylpropan-2-yl]-2-methylpropanethioamide |
|---|---|
| PubChem CID | 178058528 |
| Molecular Formula | C24H30F6N4OS |
| Molecular Weight | 536.59 g/mol |
| Exact Mass | 536.20 |
| IUPAC Name | 3-[1-(difluoromethyl)-2H-azet-3-yl]-N-[1-[5-[(2E)-2-fluoro-6-methyl-1-oxohepta-2,4-dien-4-yl]-3-(trifluoromethyl)pyrazol-1-yl]-2-methylpropan-2-yl]-2-methylpropanethioamide |
| SMILES | CC(C)C=C(/C=C(/F)C=O)c1cc(C(F)(F)F)nn1CC(C)(C)NC(=S)C(C)CC1=CN(C(F)F)C1 |
| InChI | InChI=1S/C24H30F6N4OS/c1-14(2)6-17(8-18(25)12-35)19-9-20(24(28,29)30)32-34(19)13-23(4,5)31-21(36)15(3)7-16-10-33(11-16)22(26)27/h6,8-10,12,14-15,22H,7,11,13H2,1-5H3,(H,31,36)/b17-6?,18-8+ |
| InChIKey | IVTAFEMROUKUEY-LVSDXMROSA-N |
| XLogP | 6.14 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.59 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|