C19H16Cl2N4O4 — CID 178058863
ethyl (E)-3-amino-3-(3,4-dichlorophenyl)-2-(6,7-dihydro-[1,4]dioxino[2,3-f]benzotriazol-3-yl)prop-2-enoate (PubChem CID 178058863) has the molecular formula C19H16Cl2N4O4 and a molecular weight of 435.27 g/mol. Its IUPAC name is ethyl (E)-3-amino-3-(3,4-dichlorophenyl)-2-(6,7-dihydro-[1,4]dioxino[2,3-f]benzotriazol-3-yl)prop-2-enoate.
| Compound Name | ethyl (E)-3-amino-3-(3,4-dichlorophenyl)-2-(6,7-dihydro-[1,4]dioxino[2,3-f]benzotriazol-3-yl)prop-2-enoate |
|---|---|
| PubChem CID | 178058863 |
| Molecular Formula | C19H16Cl2N4O4 |
| Molecular Weight | 435.27 g/mol |
| Exact Mass | 434.05 |
| IUPAC Name | ethyl (E)-3-amino-3-(3,4-dichlorophenyl)-2-(6,7-dihydro-[1,4]dioxino[2,3-f]benzotriazol-3-yl)prop-2-enoate |
| SMILES | CCOC(=O)/C(=C(\N)c1ccc(Cl)c(Cl)c1)n1nnc2cc3c(cc21)OCCO3 |
| InChI | InChI=1S/C19H16Cl2N4O4/c1-2-27-19(26)18(17(22)10-3-4-11(20)12(21)7-10)25-14-9-16-15(28-5-6-29-16)8-13(14)23-24-25/h3-4,7-9H,2,5-6,22H2,1H3/b18-17+ |
| InChIKey | YIZLHTDWPOQGRF-ISLYRVAYSA-N |
| XLogP | 3.36 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.27 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|