C27H13Cl2F2N7O2 — CID 178058924
6-(5,6-dichloro-3-pyridinyl)-5-(5,6-difluorobenzotriazol-1-yl)-3-isoquinolin-4-yl-1-prop-2-ynylpyrimidine-2,4-dione (PubChem CID 178058924) has the molecular formula C27H13Cl2F2N7O2 and a molecular weight of 576.35 g/mol. Its IUPAC name is 6-(5,6-dichloro-3-pyridinyl)-5-(5,6-difluorobenzotriazol-1-yl)-3-isoquinolin-4-yl-1-prop-2-ynylpyrimidine-2,4-dione.
| Compound Name | 6-(5,6-dichloro-3-pyridinyl)-5-(5,6-difluorobenzotriazol-1-yl)-3-isoquinolin-4-yl-1-prop-2-ynylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 178058924 |
| Molecular Formula | C27H13Cl2F2N7O2 |
| Molecular Weight | 576.35 g/mol |
| Exact Mass | 575.05 |
| IUPAC Name | 6-(5,6-dichloro-3-pyridinyl)-5-(5,6-difluorobenzotriazol-1-yl)-3-isoquinolin-4-yl-1-prop-2-ynylpyrimidine-2,4-dione |
| SMILES | C#CCn1c(-c2cnc(Cl)c(Cl)c2)c(-n2nnc3cc(F)c(F)cc32)c(=O)n(-c2cncc3ccccc23)c1=O |
| InChI | InChI=1S/C27H13Cl2F2N7O2/c1-2-7-36-23(15-8-17(28)25(29)33-12-15)24(38-21-10-19(31)18(30)9-20(21)34-35-38)26(39)37(27(36)40)22-13-32-11-14-5-3-4-6-16(14)22/h1,3-6,8-13H,7H2 |
| InChIKey | KFYVFZNCPSWBML-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 100.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.35 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|