C26H18ClF3N6O2 — CID 178058930
6-[3-chloro-4-(trifluoromethyl)phenyl]-5-(N,2-diaminoanilino)-3-isoquinolin-4-yl-1H-pyrimidine-2,4-dione (PubChem CID 178058930) has the molecular formula C26H18ClF3N6O2 and a molecular weight of 538.92 g/mol. Its IUPAC name is 6-[3-chloro-4-(trifluoromethyl)phenyl]-5-(N,2-diaminoanilino)-3-isoquinolin-4-yl-1H-pyrimidine-2,4-dione.
| Compound Name | 6-[3-chloro-4-(trifluoromethyl)phenyl]-5-(N,2-diaminoanilino)-3-isoquinolin-4-yl-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 178058930 |
| Molecular Formula | C26H18ClF3N6O2 |
| Molecular Weight | 538.92 g/mol |
| Exact Mass | 538.11 |
| IUPAC Name | 6-[3-chloro-4-(trifluoromethyl)phenyl]-5-(N,2-diaminoanilino)-3-isoquinolin-4-yl-1H-pyrimidine-2,4-dione |
| SMILES | Nc1ccccc1N(N)c1c(-c2ccc(C(F)(F)F)c(Cl)c2)[nH]c(=O)n(-c2cncc3ccccc23)c1=O |
| InChI | InChI=1S/C26H18ClF3N6O2/c27-18-11-14(9-10-17(18)26(28,29)30)22-23(36(32)20-8-4-3-7-19(20)31)24(37)35(25(38)34-22)21-13-33-12-15-5-1-2-6-16(15)21/h1-13H,31-32H2,(H,34,38) |
| InChIKey | QPIVUXQZGOVRFR-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 123.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.92 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|