C17H16F2N6O2 — CID 178058970
5-(N,2-diamino-4,5-difluoroanilino)-6-methyl-3-(6-methyl-3-pyridinyl)-1H-pyrimidine-2,4-dione (PubChem CID 178058970) has the molecular formula C17H16F2N6O2 and a molecular weight of 374.35 g/mol. Its IUPAC name is 5-(N,2-diamino-4,5-difluoroanilino)-6-methyl-3-(6-methyl-3-pyridinyl)-1H-pyrimidine-2,4-dione.
| Compound Name | 5-(N,2-diamino-4,5-difluoroanilino)-6-methyl-3-(6-methyl-3-pyridinyl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 178058970 |
| Molecular Formula | C17H16F2N6O2 |
| Molecular Weight | 374.35 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 5-(N,2-diamino-4,5-difluoroanilino)-6-methyl-3-(6-methyl-3-pyridinyl)-1H-pyrimidine-2,4-dione |
| SMILES | Cc1ccc(-n2c(=O)[nH]c(C)c(N(N)c3cc(F)c(F)cc3N)c2=O)cn1 |
| InChI | InChI=1S/C17H16F2N6O2/c1-8-3-4-10(7-22-8)24-16(26)15(9(2)23-17(24)27)25(21)14-6-12(19)11(18)5-13(14)20/h3-7H,20-21H2,1-2H3,(H,23,27) |
| InChIKey | NFWISYBYNUTVHC-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 123.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.35 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|