C32H35ClN5O3+ — CID 178060230
2-[[4-[(2S)-2-(5-chloro-2-pyridinyl)-2-methyl-1,3-benzodioxol-4-yl]piperidin-1-yl]methyl]-3-(4,4-dimethyloxolan-3-ylidene)benzimidazol-3-ium-5-amine (PubChem CID 178060230) has the molecular formula C32H35ClN5O3+ and a molecular weight of 573.12 g/mol. Its IUPAC name is 2-[[4-[(2S)-2-(5-chloro-2-pyridinyl)-2-methyl-1,3-benzodioxol-4-yl]piperidin-1-yl]methyl]-3-(4,4-dimethyloxolan-3-ylidene)benzimidazol-3-ium-5-amine.
| Compound Name | 2-[[4-[(2S)-2-(5-chloro-2-pyridinyl)-2-methyl-1,3-benzodioxol-4-yl]piperidin-1-yl]methyl]-3-(4,4-dimethyloxolan-3-ylidene)benzimidazol-3-ium-5-amine |
|---|---|
| PubChem CID | 178060230 |
| Molecular Formula | C32H35ClN5O3+ |
| Molecular Weight | 573.12 g/mol |
| Exact Mass | 572.24 |
| IUPAC Name | 2-[[4-[(2S)-2-(5-chloro-2-pyridinyl)-2-methyl-1,3-benzodioxol-4-yl]piperidin-1-yl]methyl]-3-(4,4-dimethyloxolan-3-ylidene)benzimidazol-3-ium-5-amine |
| SMILES | CC1(C)COC/C1=[N+]1\C(CN2CCC(c3cccc4c3O[C@@](C)(c3ccc(Cl)cn3)O4)CC2)=Nc2ccc(N)cc21 |
| InChI | InChI=1S/C32H35ClN5O3/c1-31(2)19-39-18-28(31)38-25-15-22(34)8-9-24(25)36-29(38)17-37-13-11-20(12-14-37)23-5-4-6-26-30(23)41-32(3,40-26)27-10-7-21(33)16-35-27/h4-10,15-16,20H,11-14,17-19,34H2,1-3H3/q+1/b38-28+/t32-/m0/s1 |
| InChIKey | CYGFNNBYVPJDOI-ZAKBYLTGSA-N |
| XLogP | 6.03 |
| TPSA | 85.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.12 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|