About ethane;2-methylthieno[2,3-d]pyridazin-4-amine
ethane;2-methylthieno[2,3-d]pyridazin-4-amine (PubChem CID 178061037) has the molecular formula C9H13N3S
and a molecular weight of 195.29 g/mol. Its IUPAC name is ethane;2-methylthieno[2,3-d]pyridazin-4-amine.
Molecular Properties
| Compound Name | ethane;2-methylthieno[2,3-d]pyridazin-4-amine |
| PubChem CID | 178061037 |
| Molecular Formula | C9H13N3S |
| Molecular Weight | 195.29 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | ethane;2-methylthieno[2,3-d]pyridazin-4-amine |
| SMILES | CC.Cc1cc2c(N)nncc2s1 |
| InChI | InChI=1S/C7H7N3S.C2H6/c1-4-2-5-6(11-4)3-9-10-7(5)8;1-2/h2-3H,1H3,(H2,8,10);1-2H3 |
| InChIKey | HGQWFEAXZZMXQJ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.29 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;2-methylthieno[2,3-d]pyridazin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methylthieno[2,3-d]pyridazin-4-amine?
The IUPAC name of ethane;2-methylthieno[2,3-d]pyridazin-4-amine (CID 178061037) is ethane;2-methylthieno[2,3-d]pyridazin-4-amine.
What is the SMILES notation for ethane;2-methylthieno[2,3-d]pyridazin-4-amine?
The canonical SMILES for ethane;2-methylthieno[2,3-d]pyridazin-4-amine is CC.Cc1cc2c(N)nncc2s1.
What is the InChIKey of ethane;2-methylthieno[2,3-d]pyridazin-4-amine?
The InChIKey is HGQWFEAXZZMXQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3S.C2H6/c1-4-2-5-6(11-4)3-9-10-7(5)8;1-2/h2-3H,1H3,(H2,8,10);1-2H3.
What are the key properties of ethane;2-methylthieno[2,3-d]pyridazin-4-amine?
ethane;2-methylthieno[2,3-d]pyridazin-4-amine has a molecular weight of 195.29 g/mol, XLogP of 2.61, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methylthieno[2,3-d]pyridazin-4-amine is sourced from PubChem (CID 178061037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).