C9H13N3S — CID 178061037
ethane;2-methylthieno[2,3-d]pyridazin-4-amine (PubChem CID 178061037) has the molecular formula C9H13N3S and a molecular weight of 195.29 g/mol. Its IUPAC name is ethane;2-methylthieno[2,3-d]pyridazin-4-amine.
| Compound Name | ethane;2-methylthieno[2,3-d]pyridazin-4-amine |
|---|---|
| PubChem CID | 178061037 |
| Molecular Formula | C9H13N3S |
| Molecular Weight | 195.29 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | ethane;2-methylthieno[2,3-d]pyridazin-4-amine |
| SMILES | CC.Cc1cc2c(N)nncc2s1 |
| InChI | InChI=1S/C7H7N3S.C2H6/c1-4-2-5-6(11-4)3-9-10-7(5)8;1-2/h2-3H,1H3,(H2,8,10);1-2H3 |
| InChIKey | HGQWFEAXZZMXQJ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.29 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |