About 1-chloro-4-ethenylbenzene;2,2-dimethyl-1,3-oxazolidine
1-chloro-4-ethenylbenzene;2,2-dimethyl-1,3-oxazolidine (PubChem CID 178061148) has the molecular formula C13H18ClNO
and a molecular weight of 239.75 g/mol. Its IUPAC name is 1-chloro-4-ethenylbenzene;2,2-dimethyl-1,3-oxazolidine.
Molecular Properties
| Compound Name | 1-chloro-4-ethenylbenzene;2,2-dimethyl-1,3-oxazolidine |
| PubChem CID | 178061148 |
| Molecular Formula | C13H18ClNO |
| Molecular Weight | 239.75 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 1-chloro-4-ethenylbenzene;2,2-dimethyl-1,3-oxazolidine |
| SMILES | C=Cc1ccc(Cl)cc1.CC1(C)NCCO1 |
| InChI | InChI=1S/C8H7Cl.C5H11NO/c1-2-7-3-5-8(9)6-4-7;1-5(2)6-3-4-7-5/h2-6H,1H2;6H,3-4H2,1-2H3 |
| InChIKey | BTJCQEYKUYSMDW-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.75 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-chloro-4-ethenylbenzene;2,2-dimethyl-1,3-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-4-ethenylbenzene;2,2-dimethyl-1,3-oxazolidine?
The IUPAC name of 1-chloro-4-ethenylbenzene;2,2-dimethyl-1,3-oxazolidine (CID 178061148) is 1-chloro-4-ethenylbenzene;2,2-dimethyl-1,3-oxazolidine.
What is the SMILES notation for 1-chloro-4-ethenylbenzene;2,2-dimethyl-1,3-oxazolidine?
The canonical SMILES for 1-chloro-4-ethenylbenzene;2,2-dimethyl-1,3-oxazolidine is C=Cc1ccc(Cl)cc1.CC1(C)NCCO1.
What is the InChIKey of 1-chloro-4-ethenylbenzene;2,2-dimethyl-1,3-oxazolidine?
The InChIKey is BTJCQEYKUYSMDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7Cl.C5H11NO/c1-2-7-3-5-8(9)6-4-7;1-5(2)6-3-4-7-5/h2-6H,1H2;6H,3-4H2,1-2H3.
What are the key properties of 1-chloro-4-ethenylbenzene;2,2-dimethyl-1,3-oxazolidine?
1-chloro-4-ethenylbenzene;2,2-dimethyl-1,3-oxazolidine has a molecular weight of 239.75 g/mol, XLogP of 3.33, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-4-ethenylbenzene;2,2-dimethyl-1,3-oxazolidine is sourced from PubChem (CID 178061148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).