About ethane;(Z)-4-(methylamino)-5-(2-oxopropylamino)-1-piperazin-1-ylpent-4-en-1-one
ethane;(Z)-4-(methylamino)-5-(2-oxopropylamino)-1-piperazin-1-ylpent-4-en-1-one (PubChem CID 178062628) has the molecular formula C15H30N4O2
and a molecular weight of 298.43 g/mol. Its IUPAC name is ethane;(Z)-4-(methylamino)-5-(2-oxopropylamino)-1-piperazin-1-ylpent-4-en-1-one.
Molecular Properties
| Compound Name | ethane;(Z)-4-(methylamino)-5-(2-oxopropylamino)-1-piperazin-1-ylpent-4-en-1-one |
| PubChem CID | 178062628 |
| Molecular Formula | C15H30N4O2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.24 |
| IUPAC Name | ethane;(Z)-4-(methylamino)-5-(2-oxopropylamino)-1-piperazin-1-ylpent-4-en-1-one |
| SMILES | CC.CN/C(=C\NCC(C)=O)CCC(=O)N1CCNCC1 |
| InChI | InChI=1S/C13H24N4O2.C2H6/c1-11(18)9-16-10-12(14-2)3-4-13(19)17-7-5-15-6-8-17;1-2/h10,14-16H,3-9H2,1-2H3;1-2H3/b12-10-; |
| InChIKey | NSMDXNVFVLIBBV-BBJSDXRSSA-N |
| XLogP | 0.46 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethane;(Z)-4-(methylamino)-5-(2-oxopropylamino)-1-piperazin-1-ylpent-4-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(Z)-4-(methylamino)-5-(2-oxopropylamino)-1-piperazin-1-ylpent-4-en-1-one?
The IUPAC name of ethane;(Z)-4-(methylamino)-5-(2-oxopropylamino)-1-piperazin-1-ylpent-4-en-1-one (CID 178062628) is ethane;(Z)-4-(methylamino)-5-(2-oxopropylamino)-1-piperazin-1-ylpent-4-en-1-one.
What is the SMILES notation for ethane;(Z)-4-(methylamino)-5-(2-oxopropylamino)-1-piperazin-1-ylpent-4-en-1-one?
The canonical SMILES for ethane;(Z)-4-(methylamino)-5-(2-oxopropylamino)-1-piperazin-1-ylpent-4-en-1-one is CC.CN/C(=C\NCC(C)=O)CCC(=O)N1CCNCC1.
What is the InChIKey of ethane;(Z)-4-(methylamino)-5-(2-oxopropylamino)-1-piperazin-1-ylpent-4-en-1-one?
The InChIKey is NSMDXNVFVLIBBV-BBJSDXRSSA-N. The full InChI is InChI=1S/C13H24N4O2.C2H6/c1-11(18)9-16-10-12(14-2)3-4-13(19)17-7-5-15-6-8-17;1-2/h10,14-16H,3-9H2,1-2H3;1-2H3/b12-10-;.
What are the key properties of ethane;(Z)-4-(methylamino)-5-(2-oxopropylamino)-1-piperazin-1-ylpent-4-en-1-one?
ethane;(Z)-4-(methylamino)-5-(2-oxopropylamino)-1-piperazin-1-ylpent-4-en-1-one has a molecular weight of 298.43 g/mol, XLogP of 0.46, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(Z)-4-(methylamino)-5-(2-oxopropylamino)-1-piperazin-1-ylpent-4-en-1-one is sourced from PubChem (CID 178062628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).