C24H38N2O7S — CID 178063217
N-[[4-(2,3-dimethylthiazet-4-yl)-2-[2-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]phenyl]methyl]formamide (PubChem CID 178063217) has the molecular formula C24H38N2O7S and a molecular weight of 498.64 g/mol. Its IUPAC name is N-[[4-(2,3-dimethylthiazet-4-yl)-2-[2-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]phenyl]methyl]formamide.
| Compound Name | N-[[4-(2,3-dimethylthiazet-4-yl)-2-[2-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]phenyl]methyl]formamide |
|---|---|
| PubChem CID | 178063217 |
| Molecular Formula | C24H38N2O7S |
| Molecular Weight | 498.64 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | N-[[4-(2,3-dimethylthiazet-4-yl)-2-[2-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]phenyl]methyl]formamide |
| SMILES | CCOCCOCCOCCOCCOCCOc1cc(-c2sn(C)c2C)ccc1CNC=O |
| InChI | InChI=1S/C24H38N2O7S/c1-4-28-7-8-29-9-10-30-11-12-31-13-14-32-15-16-33-23-17-21(24-20(2)26(3)34-24)5-6-22(23)18-25-19-27/h5-6,17,19H,4,7-16,18H2,1-3H3,(H,25,27) |
| InChIKey | HVJXFKHMUIHGLT-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 89.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.64 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|