C23H36N4O — CID 178064414
1-[3-(5-methylimidazol-1-yl)propyl]-3-[(3,4,8,9-tetramethyl-1-tetracyclo[4.4.0.03,9.04,8]decanyl)methyl]urea (PubChem CID 178064414) has the molecular formula C23H36N4O and a molecular weight of 384.57 g/mol. Its IUPAC name is 1-[3-(5-methylimidazol-1-yl)propyl]-3-[(3,4,8,9-tetramethyl-1-tetracyclo[4.4.0.03,9.04,8]decanyl)methyl]urea.
| Compound Name | 1-[3-(5-methylimidazol-1-yl)propyl]-3-[(3,4,8,9-tetramethyl-1-tetracyclo[4.4.0.03,9.04,8]decanyl)methyl]urea |
|---|---|
| PubChem CID | 178064414 |
| Molecular Formula | C23H36N4O |
| Molecular Weight | 384.57 g/mol |
| Exact Mass | 384.29 |
| IUPAC Name | 1-[3-(5-methylimidazol-1-yl)propyl]-3-[(3,4,8,9-tetramethyl-1-tetracyclo[4.4.0.03,9.04,8]decanyl)methyl]urea |
| SMILES | Cc1cncn1CCCNC(=O)NCC12CC3(C)C4(C)CC1CC4(C)C3(C)C2 |
| InChI | InChI=1S/C23H36N4O/c1-16-11-24-15-27(16)8-6-7-25-18(28)26-14-23-12-21(4)19(2)9-17(23)10-20(19,3)22(21,5)13-23/h11,15,17H,6-10,12-14H2,1-5H3,(H2,25,26,28) |
| InChIKey | ZFPMAHLXIYTHDP-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.57 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|