C35H32N2O7S2 — CID 178064472
3-[[3-[3-[4-[[[3-(4-hydroxyphenyl)benzoyl]amino]methyl]-2-methylphenoxy]propyl]phenyl]sulfamoyl]thiophene-2-carboxylic acid (PubChem CID 178064472) has the molecular formula C35H32N2O7S2 and a molecular weight of 656.78 g/mol. Its IUPAC name is 3-[[3-[3-[4-[[[3-(4-hydroxyphenyl)benzoyl]amino]methyl]-2-methylphenoxy]propyl]phenyl]sulfamoyl]thiophene-2-carboxylic acid.
| Compound Name | 3-[[3-[3-[4-[[[3-(4-hydroxyphenyl)benzoyl]amino]methyl]-2-methylphenoxy]propyl]phenyl]sulfamoyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 178064472 |
| Molecular Formula | C35H32N2O7S2 |
| Molecular Weight | 656.78 g/mol |
| Exact Mass | 656.17 |
| IUPAC Name | 3-[[3-[3-[4-[[[3-(4-hydroxyphenyl)benzoyl]amino]methyl]-2-methylphenoxy]propyl]phenyl]sulfamoyl]thiophene-2-carboxylic acid |
| SMILES | Cc1cc(CNC(=O)c2cccc(-c3ccc(O)cc3)c2)ccc1OCCCc1cccc(NS(=O)(=O)c2ccsc2C(=O)O)c1 |
| InChI | InChI=1S/C35H32N2O7S2/c1-23-19-25(22-36-34(39)28-8-3-7-27(21-28)26-11-13-30(38)14-12-26)10-15-31(23)44-17-4-6-24-5-2-9-29(20-24)37-46(42,43)32-16-18-45-33(32)35(40)41/h2-3,5,7-16,18-21,37-38H,4,6,17,22H2,1H3,(H,36,39)(H,40,41) |
| InChIKey | MHHNUQJOBCOGRT-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 142.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.78 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|