C14H29NO5 — CID 178064876
1-[2-hydroxy-1-[(1-hydroxy-2,6,6-trimethylpiperidin-2-yl)methoxy]ethoxy]propan-2-ol (PubChem CID 178064876) has the molecular formula C14H29NO5 and a molecular weight of 291.39 g/mol. Its IUPAC name is 1-[2-hydroxy-1-[(1-hydroxy-2,6,6-trimethylpiperidin-2-yl)methoxy]ethoxy]propan-2-ol.
| Compound Name | 1-[2-hydroxy-1-[(1-hydroxy-2,6,6-trimethylpiperidin-2-yl)methoxy]ethoxy]propan-2-ol |
|---|---|
| PubChem CID | 178064876 |
| Molecular Formula | C14H29NO5 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | 1-[2-hydroxy-1-[(1-hydroxy-2,6,6-trimethylpiperidin-2-yl)methoxy]ethoxy]propan-2-ol |
| SMILES | CC(O)COC(CO)OCC1(C)CCCC(C)(C)N1O |
| InChI | InChI=1S/C14H29NO5/c1-11(17)9-19-12(8-16)20-10-14(4)7-5-6-13(2,3)15(14)18/h11-12,16-18H,5-10H2,1-4H3 |
| InChIKey | UEQMKQKFXMAXOG-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 82.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|