About 1,3-dihydropyrrolo[2,3-c]quinolin-2-one
1,3-dihydropyrrolo[2,3-c]quinolin-2-one (PubChem CID 178065999) has the molecular formula C11H8N2O
and a molecular weight of 184.20 g/mol. Its IUPAC name is 1,3-dihydropyrrolo[2,3-c]quinolin-2-one.
Molecular Properties
| Compound Name | 1,3-dihydropyrrolo[2,3-c]quinolin-2-one |
| PubChem CID | 178065999 |
| Molecular Formula | C11H8N2O |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | 1,3-dihydropyrrolo[2,3-c]quinolin-2-one |
| SMILES | O=C1Cc2c(cnc3ccccc23)N1 |
| InChI | InChI=1S/C11H8N2O/c14-11-5-8-7-3-1-2-4-9(7)12-6-10(8)13-11/h1-4,6H,5H2,(H,13,14) |
| InChIKey | MNSUZZGOMLUZHW-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,3-dihydropyrrolo[2,3-c]quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dihydropyrrolo[2,3-c]quinolin-2-one?
The IUPAC name of 1,3-dihydropyrrolo[2,3-c]quinolin-2-one (CID 178065999) is 1,3-dihydropyrrolo[2,3-c]quinolin-2-one.
What is the SMILES notation for 1,3-dihydropyrrolo[2,3-c]quinolin-2-one?
The canonical SMILES for 1,3-dihydropyrrolo[2,3-c]quinolin-2-one is O=C1Cc2c(cnc3ccccc23)N1.
What is the InChIKey of 1,3-dihydropyrrolo[2,3-c]quinolin-2-one?
The InChIKey is MNSUZZGOMLUZHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2O/c14-11-5-8-7-3-1-2-4-9(7)12-6-10(8)13-11/h1-4,6H,5H2,(H,13,14).
What are the key properties of 1,3-dihydropyrrolo[2,3-c]quinolin-2-one?
1,3-dihydropyrrolo[2,3-c]quinolin-2-one has a molecular weight of 184.20 g/mol, XLogP of 1.73, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dihydropyrrolo[2,3-c]quinolin-2-one is sourced from PubChem (CID 178065999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).