C24H24FN11O — CID 178066055
2-[(2R)-2-(2-fluoroethoxymethyl)-4-[5-[2-[2-(2-methylpyrazol-3-yl)pyrimidin-5-yl]ethynyl]pyrimidin-2-yl]piperazin-1-yl]-1,3,5-triazine (PubChem CID 178066055) has the molecular formula C24H24FN11O and a molecular weight of 501.53 g/mol. Its IUPAC name is 2-[(2R)-2-(2-fluoroethoxymethyl)-4-[5-[2-[2-(2-methylpyrazol-3-yl)pyrimidin-5-yl]ethynyl]pyrimidin-2-yl]piperazin-1-yl]-1,3,5-triazine.
| Compound Name | 2-[(2R)-2-(2-fluoroethoxymethyl)-4-[5-[2-[2-(2-methylpyrazol-3-yl)pyrimidin-5-yl]ethynyl]pyrimidin-2-yl]piperazin-1-yl]-1,3,5-triazine |
|---|---|
| PubChem CID | 178066055 |
| Molecular Formula | C24H24FN11O |
| Molecular Weight | 501.53 g/mol |
| Exact Mass | 501.21 |
| IUPAC Name | 2-[(2R)-2-(2-fluoroethoxymethyl)-4-[5-[2-[2-(2-methylpyrazol-3-yl)pyrimidin-5-yl]ethynyl]pyrimidin-2-yl]piperazin-1-yl]-1,3,5-triazine |
| SMILES | Cn1nccc1-c1ncc(C#Cc2cnc(N3CCN(c4ncncn4)[C@@H](COCCF)C3)nc2)cn1 |
| InChI | InChI=1S/C24H24FN11O/c1-34-21(4-6-33-34)22-27-10-18(11-28-22)2-3-19-12-29-23(30-13-19)35-7-8-36(24-31-16-26-17-32-24)20(14-35)15-37-9-5-25/h4,6,10-13,16-17,20H,5,7-9,14-15H2,1H3/t20-/m1/s1 |
| InChIKey | UYAHNONSWYQBKJ-HXUWFJFHSA-N |
| XLogP | 0.93 |
| TPSA | 123.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.53 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|