C27H29FO5 — CID 178066520
(2R,3R,3aR,10aS)-3-[(E)-3-[1-(2-fluoro-5-methylphenyl)cyclopropyl]-3-hydroxyprop-1-enyl]-2-hydroxy-2,3,3a,4,5,10a-hexahydro-1H-cyclopenta[b][1]benzoxepine-8-carboxylic acid (PubChem CID 178066520) has the molecular formula C27H29FO5 and a molecular weight of 452.52 g/mol. Its IUPAC name is (2R,3R,3aR,10aS)-3-[(E)-3-[1-(2-fluoro-5-methylphenyl)cyclopropyl]-3-hydroxyprop-1-enyl]-2-hydroxy-2,3,3a,4,5,10a-hexahydro-1H-cyclopenta[b][1]benzoxepine-8-carboxylic acid.
| Compound Name | (2R,3R,3aR,10aS)-3-[(E)-3-[1-(2-fluoro-5-methylphenyl)cyclopropyl]-3-hydroxyprop-1-enyl]-2-hydroxy-2,3,3a,4,5,10a-hexahydro-1H-cyclopenta[b][1]benzoxepine-8-carboxylic acid |
|---|---|
| PubChem CID | 178066520 |
| Molecular Formula | C27H29FO5 |
| Molecular Weight | 452.52 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | (2R,3R,3aR,10aS)-3-[(E)-3-[1-(2-fluoro-5-methylphenyl)cyclopropyl]-3-hydroxyprop-1-enyl]-2-hydroxy-2,3,3a,4,5,10a-hexahydro-1H-cyclopenta[b][1]benzoxepine-8-carboxylic acid |
| SMILES | Cc1ccc(F)c(C2(C(O)/C=C/[C@@H]3[C@H]4CCc5ccc(C(=O)O)cc5O[C@H]4C[C@H]3O)CC2)c1 |
| InChI | InChI=1S/C27H29FO5/c1-15-2-8-21(28)20(12-15)27(10-11-27)25(30)9-7-18-19-6-5-16-3-4-17(26(31)32)13-23(16)33-24(19)14-22(18)29/h2-4,7-9,12-13,18-19,22,24-25,29-30H,5-6,10-11,14H2,1H3,(H,31,32)/b9-7+/t18-,19-,22-,24+,25?/m1/s1 |
| InChIKey | XGRAGHCMQBFZEL-ZQJAYNTKSA-N |
| XLogP | 4.17 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.52 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|