C24H23ClF2O4 — CID 178066605
(2R,3R,3aR,10aS)-2-chloro-3-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-2,3,3a,4,5,10a-hexahydro-1H-cyclopenta[b][1]benzoxepine-8-carboxylic acid (PubChem CID 178066605) has the molecular formula C24H23ClF2O4 and a molecular weight of 448.89 g/mol. Its IUPAC name is (2R,3R,3aR,10aS)-2-chloro-3-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-2,3,3a,4,5,10a-hexahydro-1H-cyclopenta[b][1]benzoxepine-8-carboxylic acid.
| Compound Name | (2R,3R,3aR,10aS)-2-chloro-3-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-2,3,3a,4,5,10a-hexahydro-1H-cyclopenta[b][1]benzoxepine-8-carboxylic acid |
|---|---|
| PubChem CID | 178066605 |
| Molecular Formula | C24H23ClF2O4 |
| Molecular Weight | 448.89 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | (2R,3R,3aR,10aS)-2-chloro-3-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-2,3,3a,4,5,10a-hexahydro-1H-cyclopenta[b][1]benzoxepine-8-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)O[C@H]1C[C@@H](Cl)[C@H](/C=C/C(O)C(F)(F)c3ccccc3)[C@H]1CC2 |
| InChI | InChI=1S/C24H23ClF2O4/c25-19-13-21-18(9-8-14-6-7-15(23(29)30)12-20(14)31-21)17(19)10-11-22(28)24(26,27)16-4-2-1-3-5-16/h1-7,10-12,17-19,21-22,28H,8-9,13H2,(H,29,30)/b11-10+/t17-,18-,19-,21+,22?/m1/s1 |
| InChIKey | AMOQJZBEBPUZCY-FGAZBBHRSA-N |
| XLogP | 5.03 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.89 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|