C24H34O6 — CID 178066654
(2R,3R,3aR,10aS)-3-[(E)-5-ethoxy-3-hydroxy-4,4-dimethylpent-1-enyl]-2-hydroxy-9-methyl-2,3,3a,4,5,10a-hexahydro-1H-cyclopenta[b][1]benzoxepine-8-carboxylic acid (PubChem CID 178066654) has the molecular formula C24H34O6 and a molecular weight of 418.53 g/mol. Its IUPAC name is (2R,3R,3aR,10aS)-3-[(E)-5-ethoxy-3-hydroxy-4,4-dimethylpent-1-enyl]-2-hydroxy-9-methyl-2,3,3a,4,5,10a-hexahydro-1H-cyclopenta[b][1]benzoxepine-8-carboxylic acid.
| Compound Name | (2R,3R,3aR,10aS)-3-[(E)-5-ethoxy-3-hydroxy-4,4-dimethylpent-1-enyl]-2-hydroxy-9-methyl-2,3,3a,4,5,10a-hexahydro-1H-cyclopenta[b][1]benzoxepine-8-carboxylic acid |
|---|---|
| PubChem CID | 178066654 |
| Molecular Formula | C24H34O6 |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | (2R,3R,3aR,10aS)-3-[(E)-5-ethoxy-3-hydroxy-4,4-dimethylpent-1-enyl]-2-hydroxy-9-methyl-2,3,3a,4,5,10a-hexahydro-1H-cyclopenta[b][1]benzoxepine-8-carboxylic acid |
| SMILES | CCOCC(C)(C)C(O)/C=C/[C@@H]1[C@H]2CCc3ccc(C(=O)O)c(C)c3O[C@H]2C[C@H]1O |
| InChI | InChI=1S/C24H34O6/c1-5-29-13-24(3,4)21(26)11-10-17-18-9-7-15-6-8-16(23(27)28)14(2)22(15)30-20(18)12-19(17)25/h6,8,10-11,17-21,25-26H,5,7,9,12-13H2,1-4H3,(H,27,28)/b11-10+/t17-,18-,19-,20+,21?/m1/s1 |
| InChIKey | GTPDHJLMVNOLRH-HJCIYNKISA-N |
| XLogP | 3.36 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|