About 2-bromo-2-pentyloctanoic acid
2-bromo-2-pentyloctanoic acid (PubChem CID 178066867) has the molecular formula C13H25BrO2
and a molecular weight of 293.24 g/mol. Its IUPAC name is 2-bromo-2-pentyloctanoic acid.
Molecular Properties
| Compound Name | 2-bromo-2-pentyloctanoic acid |
| PubChem CID | 178066867 |
| Molecular Formula | C13H25BrO2 |
| Molecular Weight | 293.24 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 2-bromo-2-pentyloctanoic acid |
| SMILES | CCCCCCC(Br)(CCCCC)C(=O)O |
| InChI | InChI=1S/C13H25BrO2/c1-3-5-7-9-11-13(14,12(15)16)10-8-6-4-2/h3-11H2,1-2H3,(H,15,16) |
| InChIKey | QQVQGCWUAZXYTM-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.24 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-2-pentyloctanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-2-pentyloctanoic acid?
The IUPAC name of 2-bromo-2-pentyloctanoic acid (CID 178066867) is 2-bromo-2-pentyloctanoic acid.
What is the SMILES notation for 2-bromo-2-pentyloctanoic acid?
The canonical SMILES for 2-bromo-2-pentyloctanoic acid is CCCCCCC(Br)(CCCCC)C(=O)O.
What is the InChIKey of 2-bromo-2-pentyloctanoic acid?
The InChIKey is QQVQGCWUAZXYTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25BrO2/c1-3-5-7-9-11-13(14,12(15)16)10-8-6-4-2/h3-11H2,1-2H3,(H,15,16).
What are the key properties of 2-bromo-2-pentyloctanoic acid?
2-bromo-2-pentyloctanoic acid has a molecular weight of 293.24 g/mol, XLogP of 4.76, 10 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-2-pentyloctanoic acid is sourced from PubChem (CID 178066867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).