About 1H-azonin-4-yl trifluoromethanesulfonate
1H-azonin-4-yl trifluoromethanesulfonate (PubChem CID 178066971) has the molecular formula C9H8F3NO3S
and a molecular weight of 267.23 g/mol. Its IUPAC name is 1H-azonin-4-yl trifluoromethanesulfonate.
Molecular Properties
| Compound Name | 1H-azonin-4-yl trifluoromethanesulfonate |
| PubChem CID | 178066971 |
| Molecular Formula | C9H8F3NO3S |
| Molecular Weight | 267.23 g/mol |
| Exact Mass | 267.02 |
| IUPAC Name | 1H-azonin-4-yl trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccccc[nH]cc1)C(F)(F)F |
| InChI | InChI=1S/C9H8F3NO3S/c10-9(11,12)17(14,15)16-8-4-2-1-3-6-13-7-5-8/h1-7,13H/b2-1-,6-3-,7-5-,8-4+ |
| InChIKey | MBHDICIXLUZXNK-MUYQKWPLSA-N |
| XLogP | 2.37 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.23 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze 1H-azonin-4-yl trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-azonin-4-yl trifluoromethanesulfonate?
The IUPAC name of 1H-azonin-4-yl trifluoromethanesulfonate (CID 178066971) is 1H-azonin-4-yl trifluoromethanesulfonate.
What is the SMILES notation for 1H-azonin-4-yl trifluoromethanesulfonate?
The canonical SMILES for 1H-azonin-4-yl trifluoromethanesulfonate is O=S(=O)(Oc1ccccc[nH]cc1)C(F)(F)F.
What is the InChIKey of 1H-azonin-4-yl trifluoromethanesulfonate?
The InChIKey is MBHDICIXLUZXNK-MUYQKWPLSA-N. The full InChI is InChI=1S/C9H8F3NO3S/c10-9(11,12)17(14,15)16-8-4-2-1-3-6-13-7-5-8/h1-7,13H/b2-1-,6-3-,7-5-,8-4+.
What are the key properties of 1H-azonin-4-yl trifluoromethanesulfonate?
1H-azonin-4-yl trifluoromethanesulfonate has a molecular weight of 267.23 g/mol, XLogP of 2.37, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-azonin-4-yl trifluoromethanesulfonate is sourced from PubChem (CID 178066971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).