C8H14N4 — CID 178067311
1,2,3-trimethyl-7,8-dihydro-2H-purine (PubChem CID 178067311) has the molecular formula C8H14N4 and a molecular weight of 166.23 g/mol. Its IUPAC name is 1,2,3-trimethyl-7,8-dihydro-2H-purine.
| Compound Name | 1,2,3-trimethyl-7,8-dihydro-2H-purine |
|---|---|
| PubChem CID | 178067311 |
| Molecular Formula | C8H14N4 |
| Molecular Weight | 166.23 g/mol |
| Exact Mass | 166.12 |
| IUPAC Name | 1,2,3-trimethyl-7,8-dihydro-2H-purine |
| SMILES | CC1N(C)C=C2NCN=C2N1C |
| InChI | InChI=1S/C8H14N4/c1-6-11(2)4-7-8(12(6)3)10-5-9-7/h4,6,9H,5H2,1-3H3 |
| InChIKey | UIAQLTCFIKSKBE-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.23 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |