About methyl 1-(4-bromophenyl)-5-hydroxy-3-propan-2-yl-4,6-dihydropyrano[3,2-d]pyrazole-5-carboxylate
methyl 1-(4-bromophenyl)-5-hydroxy-3-propan-2-yl-4,6-dihydropyrano[3,2-d]pyrazole-5-carboxylate (PubChem CID 178068275) has the molecular formula C17H19BrN2O4
and a molecular weight of 395.25 g/mol. Its IUPAC name is methyl 1-(4-bromophenyl)-5-hydroxy-3-propan-2-yl-4,6-dihydropyrano[3,2-d]pyrazole-5-carboxylate.
Molecular Properties
| Compound Name | methyl 1-(4-bromophenyl)-5-hydroxy-3-propan-2-yl-4,6-dihydropyrano[3,2-d]pyrazole-5-carboxylate |
| PubChem CID | 178068275 |
| Molecular Formula | C17H19BrN2O4 |
| Molecular Weight | 395.25 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | methyl 1-(4-bromophenyl)-5-hydroxy-3-propan-2-yl-4,6-dihydropyrano[3,2-d]pyrazole-5-carboxylate |
| SMILES | COC(=O)C1(O)COc2c(c(C(C)C)nn2-c2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C17H19BrN2O4/c1-10(2)14-13-8-17(22,16(21)23-3)9-24-15(13)20(19-14)12-6-4-11(18)5-7-12/h4-7,10,22H,8-9H2,1-3H3 |
| InChIKey | UUMDLOGVOQZNDV-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.25 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 1-(4-bromophenyl)-5-hydroxy-3-propan-2-yl-4,6-dihydropyrano[3,2-d]pyrazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-(4-bromophenyl)-5-hydroxy-3-propan-2-yl-4,6-dihydropyrano[3,2-d]pyrazole-5-carboxylate?
The IUPAC name of methyl 1-(4-bromophenyl)-5-hydroxy-3-propan-2-yl-4,6-dihydropyrano[3,2-d]pyrazole-5-carboxylate (CID 178068275) is methyl 1-(4-bromophenyl)-5-hydroxy-3-propan-2-yl-4,6-dihydropyrano[3,2-d]pyrazole-5-carboxylate.
What is the SMILES notation for methyl 1-(4-bromophenyl)-5-hydroxy-3-propan-2-yl-4,6-dihydropyrano[3,2-d]pyrazole-5-carboxylate?
The canonical SMILES for methyl 1-(4-bromophenyl)-5-hydroxy-3-propan-2-yl-4,6-dihydropyrano[3,2-d]pyrazole-5-carboxylate is COC(=O)C1(O)COc2c(c(C(C)C)nn2-c2ccc(Br)cc2)C1.
What is the InChIKey of methyl 1-(4-bromophenyl)-5-hydroxy-3-propan-2-yl-4,6-dihydropyrano[3,2-d]pyrazole-5-carboxylate?
The InChIKey is UUMDLOGVOQZNDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19BrN2O4/c1-10(2)14-13-8-17(22,16(21)23-3)9-24-15(13)20(19-14)12-6-4-11(18)5-7-12/h4-7,10,22H,8-9H2,1-3H3.
What are the key properties of methyl 1-(4-bromophenyl)-5-hydroxy-3-propan-2-yl-4,6-dihydropyrano[3,2-d]pyrazole-5-carboxylate?
methyl 1-(4-bromophenyl)-5-hydroxy-3-propan-2-yl-4,6-dihydropyrano[3,2-d]pyrazole-5-carboxylate has a molecular weight of 395.25 g/mol, XLogP of 2.60, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-(4-bromophenyl)-5-hydroxy-3-propan-2-yl-4,6-dihydropyrano[3,2-d]pyrazole-5-carboxylate is sourced from PubChem (CID 178068275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).