About 7'-bromospiro[cyclopropane-1,1'-indene]-5'-amine
7'-bromospiro[cyclopropane-1,1'-indene]-5'-amine (PubChem CID 178069075) has the molecular formula C11H10BrN
and a molecular weight of 236.11 g/mol. Its IUPAC name is 7'-bromospiro[cyclopropane-1,1'-indene]-5'-amine.
Molecular Properties
| Compound Name | 7'-bromospiro[cyclopropane-1,1'-indene]-5'-amine |
| PubChem CID | 178069075 |
| Molecular Formula | C11H10BrN |
| Molecular Weight | 236.11 g/mol |
| Exact Mass | 235.00 |
| IUPAC Name | 7'-bromospiro[cyclopropane-1,1'-indene]-5'-amine |
| SMILES | Nc1cc(Br)c2c(c1)C=CC21CC1 |
| InChI | InChI=1S/C11H10BrN/c12-9-6-8(13)5-7-1-2-11(3-4-11)10(7)9/h1-2,5-6H,3-4,13H2 |
| InChIKey | CIQBEIAPJRMODY-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.11 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 7'-bromospiro[cyclopropane-1,1'-indene]-5'-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7'-bromospiro[cyclopropane-1,1'-indene]-5'-amine?
The IUPAC name of 7'-bromospiro[cyclopropane-1,1'-indene]-5'-amine (CID 178069075) is 7'-bromospiro[cyclopropane-1,1'-indene]-5'-amine.
What is the SMILES notation for 7'-bromospiro[cyclopropane-1,1'-indene]-5'-amine?
The canonical SMILES for 7'-bromospiro[cyclopropane-1,1'-indene]-5'-amine is Nc1cc(Br)c2c(c1)C=CC21CC1.
What is the InChIKey of 7'-bromospiro[cyclopropane-1,1'-indene]-5'-amine?
The InChIKey is CIQBEIAPJRMODY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10BrN/c12-9-6-8(13)5-7-1-2-11(3-4-11)10(7)9/h1-2,5-6H,3-4,13H2.
What are the key properties of 7'-bromospiro[cyclopropane-1,1'-indene]-5'-amine?
7'-bromospiro[cyclopropane-1,1'-indene]-5'-amine has a molecular weight of 236.11 g/mol, XLogP of 3.09, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7'-bromospiro[cyclopropane-1,1'-indene]-5'-amine is sourced from PubChem (CID 178069075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).