C26H24 — CID 178069249
1-(2,2-dimethyl-3-methylidene-5-phenylpent-4-ynyl)-4-phenylbenzene (PubChem CID 178069249) has the molecular formula C26H24 and a molecular weight of 336.48 g/mol. Its IUPAC name is 1-(2,2-dimethyl-3-methylidene-5-phenylpent-4-ynyl)-4-phenylbenzene.
| Compound Name | 1-(2,2-dimethyl-3-methylidene-5-phenylpent-4-ynyl)-4-phenylbenzene |
|---|---|
| PubChem CID | 178069249 |
| Molecular Formula | C26H24 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | 1-(2,2-dimethyl-3-methylidene-5-phenylpent-4-ynyl)-4-phenylbenzene |
| SMILES | C=C(C#Cc1ccccc1)C(C)(C)Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C26H24/c1-21(14-15-22-10-6-4-7-11-22)26(2,3)20-23-16-18-25(19-17-23)24-12-8-5-9-13-24/h4-13,16-19H,1,20H2,2-3H3 |
| InChIKey | OKTWVSSZCBEJCE-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|