About 4,4-bis(trifluoromethyl)-1,3-dioxolane-2-thione
4,4-bis(trifluoromethyl)-1,3-dioxolane-2-thione (PubChem CID 178069857) has the molecular formula C5H2F6O2S
and a molecular weight of 240.12 g/mol. Its IUPAC name is 4,4-bis(trifluoromethyl)-1,3-dioxolane-2-thione.
Molecular Properties
| Compound Name | 4,4-bis(trifluoromethyl)-1,3-dioxolane-2-thione |
| PubChem CID | 178069857 |
| Molecular Formula | C5H2F6O2S |
| Molecular Weight | 240.12 g/mol |
| Exact Mass | 239.97 |
| IUPAC Name | 4,4-bis(trifluoromethyl)-1,3-dioxolane-2-thione |
| SMILES | FC(F)(F)C1(C(F)(F)F)COC(=S)O1 |
| InChI | InChI=1S/C5H2F6O2S/c6-4(7,8)3(5(9,10)11)1-12-2(14)13-3/h1H2 |
| InChIKey | JCKUJJPODSQJLG-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.12 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4,4-bis(trifluoromethyl)-1,3-dioxolane-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-bis(trifluoromethyl)-1,3-dioxolane-2-thione?
The IUPAC name of 4,4-bis(trifluoromethyl)-1,3-dioxolane-2-thione (CID 178069857) is 4,4-bis(trifluoromethyl)-1,3-dioxolane-2-thione.
What is the SMILES notation for 4,4-bis(trifluoromethyl)-1,3-dioxolane-2-thione?
The canonical SMILES for 4,4-bis(trifluoromethyl)-1,3-dioxolane-2-thione is FC(F)(F)C1(C(F)(F)F)COC(=S)O1.
What is the InChIKey of 4,4-bis(trifluoromethyl)-1,3-dioxolane-2-thione?
The InChIKey is JCKUJJPODSQJLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H2F6O2S/c6-4(7,8)3(5(9,10)11)1-12-2(14)13-3/h1H2.
What are the key properties of 4,4-bis(trifluoromethyl)-1,3-dioxolane-2-thione?
4,4-bis(trifluoromethyl)-1,3-dioxolane-2-thione has a molecular weight of 240.12 g/mol, XLogP of 2.18, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-bis(trifluoromethyl)-1,3-dioxolane-2-thione is sourced from PubChem (CID 178069857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).