C10H12N2O4 — CID 178070198
ethyl 1-(1,3-dioxol-2-ylmethyl)pyrazole-3-carboxylate (PubChem CID 178070198) has the molecular formula C10H12N2O4 and a molecular weight of 224.22 g/mol. Its IUPAC name is ethyl 1-(1,3-dioxol-2-ylmethyl)pyrazole-3-carboxylate.
| Compound Name | ethyl 1-(1,3-dioxol-2-ylmethyl)pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 178070198 |
| Molecular Formula | C10H12N2O4 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | ethyl 1-(1,3-dioxol-2-ylmethyl)pyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1ccn(CC2OC=CO2)n1 |
| InChI | InChI=1S/C10H12N2O4/c1-2-14-10(13)8-3-4-12(11-8)7-9-15-5-6-16-9/h3-6,9H,2,7H2,1H3 |
| InChIKey | JBZOHJHQOWILSF-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |