About phenyl N-(1'-cyclobutyl-6'-fluoro-2'-oxospiro[cyclopropane-1,3'-indole]-5'-yl)carbamate
phenyl N-(1'-cyclobutyl-6'-fluoro-2'-oxospiro[cyclopropane-1,3'-indole]-5'-yl)carbamate (PubChem CID 178070317) has the molecular formula C21H19FN2O3
and a molecular weight of 366.39 g/mol. Its IUPAC name is phenyl N-(1'-cyclobutyl-6'-fluoro-2'-oxospiro[cyclopropane-1,3'-indole]-5'-yl)carbamate.
Molecular Properties
| Compound Name | phenyl N-(1'-cyclobutyl-6'-fluoro-2'-oxospiro[cyclopropane-1,3'-indole]-5'-yl)carbamate |
| PubChem CID | 178070317 |
| Molecular Formula | C21H19FN2O3 |
| Molecular Weight | 366.39 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | phenyl N-(1'-cyclobutyl-6'-fluoro-2'-oxospiro[cyclopropane-1,3'-indole]-5'-yl)carbamate |
| SMILES | O=C(Nc1cc2c(cc1F)N(C1CCC1)C(=O)C21CC1)Oc1ccccc1 |
| InChI | InChI=1S/C21H19FN2O3/c22-16-12-18-15(21(9-10-21)19(25)24(18)13-5-4-6-13)11-17(16)23-20(26)27-14-7-2-1-3-8-14/h1-3,7-8,11-13H,4-6,9-10H2,(H,23,26) |
| InChIKey | VJKDAMPANYCHTK-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.39 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze phenyl N-(1'-cyclobutyl-6'-fluoro-2'-oxospiro[cyclopropane-1,3'-indole]-5'-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl N-(1'-cyclobutyl-6'-fluoro-2'-oxospiro[cyclopropane-1,3'-indole]-5'-yl)carbamate?
The IUPAC name of phenyl N-(1'-cyclobutyl-6'-fluoro-2'-oxospiro[cyclopropane-1,3'-indole]-5'-yl)carbamate (CID 178070317) is phenyl N-(1'-cyclobutyl-6'-fluoro-2'-oxospiro[cyclopropane-1,3'-indole]-5'-yl)carbamate.
What is the SMILES notation for phenyl N-(1'-cyclobutyl-6'-fluoro-2'-oxospiro[cyclopropane-1,3'-indole]-5'-yl)carbamate?
The canonical SMILES for phenyl N-(1'-cyclobutyl-6'-fluoro-2'-oxospiro[cyclopropane-1,3'-indole]-5'-yl)carbamate is O=C(Nc1cc2c(cc1F)N(C1CCC1)C(=O)C21CC1)Oc1ccccc1.
What is the InChIKey of phenyl N-(1'-cyclobutyl-6'-fluoro-2'-oxospiro[cyclopropane-1,3'-indole]-5'-yl)carbamate?
The InChIKey is VJKDAMPANYCHTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19FN2O3/c22-16-12-18-15(21(9-10-21)19(25)24(18)13-5-4-6-13)11-17(16)23-20(26)27-14-7-2-1-3-8-14/h1-3,7-8,11-13H,4-6,9-10H2,(H,23,26).
What are the key properties of phenyl N-(1'-cyclobutyl-6'-fluoro-2'-oxospiro[cyclopropane-1,3'-indole]-5'-yl)carbamate?
phenyl N-(1'-cyclobutyl-6'-fluoro-2'-oxospiro[cyclopropane-1,3'-indole]-5'-yl)carbamate has a molecular weight of 366.39 g/mol, XLogP of 4.37, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl N-(1'-cyclobutyl-6'-fluoro-2'-oxospiro[cyclopropane-1,3'-indole]-5'-yl)carbamate is sourced from PubChem (CID 178070317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).