About ethenyl-diethoxy-(10,10,10-trifluorodecan-2-yloxy)silane
ethenyl-diethoxy-(10,10,10-trifluorodecan-2-yloxy)silane (PubChem CID 178070693) has the molecular formula C16H31F3O3Si
and a molecular weight of 356.50 g/mol. Its IUPAC name is ethenyl-diethoxy-(10,10,10-trifluorodecan-2-yloxy)silane.
Molecular Properties
| Compound Name | ethenyl-diethoxy-(10,10,10-trifluorodecan-2-yloxy)silane |
| PubChem CID | 178070693 |
| Molecular Formula | C16H31F3O3Si |
| Molecular Weight | 356.50 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | ethenyl-diethoxy-(10,10,10-trifluorodecan-2-yloxy)silane |
| SMILES | C=C[Si](OCC)(OCC)OC(C)CCCCCCCC(F)(F)F |
| InChI | InChI=1S/C16H31F3O3Si/c1-5-20-23(7-3,21-6-2)22-15(4)13-11-9-8-10-12-14-16(17,18)19/h7,15H,3,5-6,8-14H2,1-2,4H3 |
| InChIKey | HDRUSCQXQPUCOB-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.50 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethenyl-diethoxy-(10,10,10-trifluorodecan-2-yloxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenyl-diethoxy-(10,10,10-trifluorodecan-2-yloxy)silane?
The IUPAC name of ethenyl-diethoxy-(10,10,10-trifluorodecan-2-yloxy)silane (CID 178070693) is ethenyl-diethoxy-(10,10,10-trifluorodecan-2-yloxy)silane.
What is the SMILES notation for ethenyl-diethoxy-(10,10,10-trifluorodecan-2-yloxy)silane?
The canonical SMILES for ethenyl-diethoxy-(10,10,10-trifluorodecan-2-yloxy)silane is C=C[Si](OCC)(OCC)OC(C)CCCCCCCC(F)(F)F.
What is the InChIKey of ethenyl-diethoxy-(10,10,10-trifluorodecan-2-yloxy)silane?
The InChIKey is HDRUSCQXQPUCOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H31F3O3Si/c1-5-20-23(7-3,21-6-2)22-15(4)13-11-9-8-10-12-14-16(17,18)19/h7,15H,3,5-6,8-14H2,1-2,4H3.
What are the key properties of ethenyl-diethoxy-(10,10,10-trifluorodecan-2-yloxy)silane?
ethenyl-diethoxy-(10,10,10-trifluorodecan-2-yloxy)silane has a molecular weight of 356.50 g/mol, XLogP of 5.42, 14 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethenyl-diethoxy-(10,10,10-trifluorodecan-2-yloxy)silane is sourced from PubChem (CID 178070693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).