C25H32ClN5O4 — CID 178071988
1-[7-(hydrazinecarbonyl)-5-methyl-2-oxo-1,4-dihydroquinazolin-3-yl]-N-(3-methoxy-4-methylphenyl)cyclohexane-1-carboxamide;hydrochloride (PubChem CID 178071988) has the molecular formula C25H32ClN5O4 and a molecular weight of 502.02 g/mol. Its IUPAC name is 1-[7-(hydrazinecarbonyl)-5-methyl-2-oxo-1,4-dihydroquinazolin-3-yl]-N-(3-methoxy-4-methylphenyl)cyclohexane-1-carboxamide;hydrochloride.
| Compound Name | 1-[7-(hydrazinecarbonyl)-5-methyl-2-oxo-1,4-dihydroquinazolin-3-yl]-N-(3-methoxy-4-methylphenyl)cyclohexane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 178071988 |
| Molecular Formula | C25H32ClN5O4 |
| Molecular Weight | 502.02 g/mol |
| Exact Mass | 501.21 |
| IUPAC Name | 1-[7-(hydrazinecarbonyl)-5-methyl-2-oxo-1,4-dihydroquinazolin-3-yl]-N-(3-methoxy-4-methylphenyl)cyclohexane-1-carboxamide;hydrochloride |
| SMILES | COc1cc(NC(=O)C2(N3Cc4c(C)cc(C(=O)NN)cc4NC3=O)CCCCC2)ccc1C.Cl |
| InChI | InChI=1S/C25H31N5O4.ClH/c1-15-7-8-18(13-21(15)34-3)27-23(32)25(9-5-4-6-10-25)30-14-19-16(2)11-17(22(31)29-26)12-20(19)28-24(30)33;/h7-8,11-13H,4-6,9-10,14,26H2,1-3H3,(H,27,32)(H,28,33)(H,29,31);1H |
| InChIKey | OZNRAKXLXBNKAC-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 125.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.02 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|