C19H24N4O2 — CID 178074037
1-(1,2-dimethyl-3-piperidin-4-ylindol-7-yl)-1,3-diazinane-2,4-dione (PubChem CID 178074037) has the molecular formula C19H24N4O2 and a molecular weight of 340.43 g/mol. Its IUPAC name is 1-(1,2-dimethyl-3-piperidin-4-ylindol-7-yl)-1,3-diazinane-2,4-dione.
| Compound Name | 1-(1,2-dimethyl-3-piperidin-4-ylindol-7-yl)-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 178074037 |
| Molecular Formula | C19H24N4O2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | 1-(1,2-dimethyl-3-piperidin-4-ylindol-7-yl)-1,3-diazinane-2,4-dione |
| SMILES | Cc1c(C2CCNCC2)c2cccc(N3CCC(=O)NC3=O)c2n1C |
| InChI | InChI=1S/C19H24N4O2/c1-12-17(13-6-9-20-10-7-13)14-4-3-5-15(18(14)22(12)2)23-11-8-16(24)21-19(23)25/h3-5,13,20H,6-11H2,1-2H3,(H,21,24,25) |
| InChIKey | CDSGDEHXNLXVQG-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 66.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|