About (Z)-(2-butylcyclopenta-2,4-dien-1-ylidene)-(dimethylamino)methanol
(Z)-(2-butylcyclopenta-2,4-dien-1-ylidene)-(dimethylamino)methanol (PubChem CID 178074585) has the molecular formula C12H19NO
and a molecular weight of 193.29 g/mol. Its IUPAC name is (Z)-(2-butylcyclopenta-2,4-dien-1-ylidene)-(dimethylamino)methanol.
Molecular Properties
| Compound Name | (Z)-(2-butylcyclopenta-2,4-dien-1-ylidene)-(dimethylamino)methanol |
| PubChem CID | 178074585 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | (Z)-(2-butylcyclopenta-2,4-dien-1-ylidene)-(dimethylamino)methanol |
| SMILES | CCCCC1=CC=C/C1=C(/O)N(C)C |
| InChI | InChI=1S/C12H19NO/c1-4-5-7-10-8-6-9-11(10)12(14)13(2)3/h6,8-9,14H,4-5,7H2,1-3H3/b12-11- |
| InChIKey | HAPRREDNXRLIRM-QXMHVHEDSA-N |
| XLogP | 3.00 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze (Z)-(2-butylcyclopenta-2,4-dien-1-ylidene)-(dimethylamino)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-(2-butylcyclopenta-2,4-dien-1-ylidene)-(dimethylamino)methanol?
The IUPAC name of (Z)-(2-butylcyclopenta-2,4-dien-1-ylidene)-(dimethylamino)methanol (CID 178074585) is (Z)-(2-butylcyclopenta-2,4-dien-1-ylidene)-(dimethylamino)methanol.
What is the SMILES notation for (Z)-(2-butylcyclopenta-2,4-dien-1-ylidene)-(dimethylamino)methanol?
The canonical SMILES for (Z)-(2-butylcyclopenta-2,4-dien-1-ylidene)-(dimethylamino)methanol is CCCCC1=CC=C/C1=C(/O)N(C)C.
What is the InChIKey of (Z)-(2-butylcyclopenta-2,4-dien-1-ylidene)-(dimethylamino)methanol?
The InChIKey is HAPRREDNXRLIRM-QXMHVHEDSA-N. The full InChI is InChI=1S/C12H19NO/c1-4-5-7-10-8-6-9-11(10)12(14)13(2)3/h6,8-9,14H,4-5,7H2,1-3H3/b12-11-.
What are the key properties of (Z)-(2-butylcyclopenta-2,4-dien-1-ylidene)-(dimethylamino)methanol?
(Z)-(2-butylcyclopenta-2,4-dien-1-ylidene)-(dimethylamino)methanol has a molecular weight of 193.29 g/mol, XLogP of 3.00, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-(2-butylcyclopenta-2,4-dien-1-ylidene)-(dimethylamino)methanol is sourced from PubChem (CID 178074585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).