About 5-(2-chlorophenyl)-1,3-benzothiazole
5-(2-chlorophenyl)-1,3-benzothiazole (PubChem CID 178074687) has the molecular formula C13H8ClNS
and a molecular weight of 245.73 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-1,3-benzothiazole.
Molecular Properties
| Compound Name | 5-(2-chlorophenyl)-1,3-benzothiazole |
| PubChem CID | 178074687 |
| Molecular Formula | C13H8ClNS |
| Molecular Weight | 245.73 g/mol |
| Exact Mass | 245.01 |
| IUPAC Name | 5-(2-chlorophenyl)-1,3-benzothiazole |
| SMILES | Clc1ccccc1-c1ccc2scnc2c1 |
| InChI | InChI=1S/C13H8ClNS/c14-11-4-2-1-3-10(11)9-5-6-13-12(7-9)15-8-16-13/h1-8H |
| InChIKey | MQBXRQJUDFQNGO-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.73 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(2-chlorophenyl)-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-chlorophenyl)-1,3-benzothiazole?
The IUPAC name of 5-(2-chlorophenyl)-1,3-benzothiazole (CID 178074687) is 5-(2-chlorophenyl)-1,3-benzothiazole.
What is the SMILES notation for 5-(2-chlorophenyl)-1,3-benzothiazole?
The canonical SMILES for 5-(2-chlorophenyl)-1,3-benzothiazole is Clc1ccccc1-c1ccc2scnc2c1.
What is the InChIKey of 5-(2-chlorophenyl)-1,3-benzothiazole?
The InChIKey is MQBXRQJUDFQNGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8ClNS/c14-11-4-2-1-3-10(11)9-5-6-13-12(7-9)15-8-16-13/h1-8H.
What are the key properties of 5-(2-chlorophenyl)-1,3-benzothiazole?
5-(2-chlorophenyl)-1,3-benzothiazole has a molecular weight of 245.73 g/mol, XLogP of 4.62, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-chlorophenyl)-1,3-benzothiazole is sourced from PubChem (CID 178074687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).