C22H19N7O — CID 178075687
N-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]-7-phenylpurin-2-amine (PubChem CID 178075687) has the molecular formula C22H19N7O and a molecular weight of 397.44 g/mol. Its IUPAC name is N-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]-7-phenylpurin-2-amine.
| Compound Name | N-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]-7-phenylpurin-2-amine |
|---|---|
| PubChem CID | 178075687 |
| Molecular Formula | C22H19N7O |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | N-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]-7-phenylpurin-2-amine |
| SMILES | COc1cc(Nc2ncc3c(ncn3-c3ccccc3)n2)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C22H19N7O/c1-15-12-28(13-24-15)18-9-8-16(10-20(18)30-2)26-22-23-11-19-21(27-22)25-14-29(19)17-6-4-3-5-7-17/h3-14H,1-2H3,(H,23,26,27) |
| InChIKey | PNPJPPJYRXJTNK-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 82.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |