About 2-chloro-7-phenyl-8,9-dihydropurine
2-chloro-7-phenyl-8,9-dihydropurine (PubChem CID 178075727) has the molecular formula C11H9ClN4
and a molecular weight of 232.67 g/mol. Its IUPAC name is 2-chloro-7-phenyl-8,9-dihydropurine.
Molecular Properties
| Compound Name | 2-chloro-7-phenyl-8,9-dihydropurine |
| PubChem CID | 178075727 |
| Molecular Formula | C11H9ClN4 |
| Molecular Weight | 232.67 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | 2-chloro-7-phenyl-8,9-dihydropurine |
| SMILES | Clc1ncc2c(n1)NCN2c1ccccc1 |
| InChI | InChI=1S/C11H9ClN4/c12-11-13-6-9-10(15-11)14-7-16(9)8-4-2-1-3-5-8/h1-6H,7H2,(H,13,14,15) |
| InChIKey | RUJOKLNMUFQPQB-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.67 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-chloro-7-phenyl-8,9-dihydropurine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-7-phenyl-8,9-dihydropurine?
The IUPAC name of 2-chloro-7-phenyl-8,9-dihydropurine (CID 178075727) is 2-chloro-7-phenyl-8,9-dihydropurine.
What is the SMILES notation for 2-chloro-7-phenyl-8,9-dihydropurine?
The canonical SMILES for 2-chloro-7-phenyl-8,9-dihydropurine is Clc1ncc2c(n1)NCN2c1ccccc1.
What is the InChIKey of 2-chloro-7-phenyl-8,9-dihydropurine?
The InChIKey is RUJOKLNMUFQPQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9ClN4/c12-11-13-6-9-10(15-11)14-7-16(9)8-4-2-1-3-5-8/h1-6H,7H2,(H,13,14,15).
What are the key properties of 2-chloro-7-phenyl-8,9-dihydropurine?
2-chloro-7-phenyl-8,9-dihydropurine has a molecular weight of 232.67 g/mol, XLogP of 2.65, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-7-phenyl-8,9-dihydropurine is sourced from PubChem (CID 178075727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).