About 2-bromo-5-(1,3-dioxol-2-yl)-1,3-thiazole
2-bromo-5-(1,3-dioxol-2-yl)-1,3-thiazole (PubChem CID 178076419) has the molecular formula C6H4BrNO2S
and a molecular weight of 234.07 g/mol. Its IUPAC name is 2-bromo-5-(1,3-dioxol-2-yl)-1,3-thiazole.
Molecular Properties
| Compound Name | 2-bromo-5-(1,3-dioxol-2-yl)-1,3-thiazole |
| PubChem CID | 178076419 |
| Molecular Formula | C6H4BrNO2S |
| Molecular Weight | 234.07 g/mol |
| Exact Mass | 232.91 |
| IUPAC Name | 2-bromo-5-(1,3-dioxol-2-yl)-1,3-thiazole |
| SMILES | Brc1ncc(C2OC=CO2)s1 |
| InChI | InChI=1S/C6H4BrNO2S/c7-6-8-3-4(11-6)5-9-1-2-10-5/h1-3,5H |
| InChIKey | QBMUVFBUFRERMD-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.07 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-bromo-5-(1,3-dioxol-2-yl)-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-5-(1,3-dioxol-2-yl)-1,3-thiazole?
The IUPAC name of 2-bromo-5-(1,3-dioxol-2-yl)-1,3-thiazole (CID 178076419) is 2-bromo-5-(1,3-dioxol-2-yl)-1,3-thiazole.
What is the SMILES notation for 2-bromo-5-(1,3-dioxol-2-yl)-1,3-thiazole?
The canonical SMILES for 2-bromo-5-(1,3-dioxol-2-yl)-1,3-thiazole is Brc1ncc(C2OC=CO2)s1.
What is the InChIKey of 2-bromo-5-(1,3-dioxol-2-yl)-1,3-thiazole?
The InChIKey is QBMUVFBUFRERMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4BrNO2S/c7-6-8-3-4(11-6)5-9-1-2-10-5/h1-3,5H.
What are the key properties of 2-bromo-5-(1,3-dioxol-2-yl)-1,3-thiazole?
2-bromo-5-(1,3-dioxol-2-yl)-1,3-thiazole has a molecular weight of 234.07 g/mol, XLogP of 2.42, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-5-(1,3-dioxol-2-yl)-1,3-thiazole is sourced from PubChem (CID 178076419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).