About 2-methyl-6H-pyrrolo[2,3-g][1,3]benzoxazole-8-carbonitrile
2-methyl-6H-pyrrolo[2,3-g][1,3]benzoxazole-8-carbonitrile (PubChem CID 178076659) has the molecular formula C11H7N3O
and a molecular weight of 197.20 g/mol. Its IUPAC name is 2-methyl-6H-pyrrolo[2,3-g][1,3]benzoxazole-8-carbonitrile.
Molecular Properties
| Compound Name | 2-methyl-6H-pyrrolo[2,3-g][1,3]benzoxazole-8-carbonitrile |
| PubChem CID | 178076659 |
| Molecular Formula | C11H7N3O |
| Molecular Weight | 197.20 g/mol |
| Exact Mass | 197.06 |
| IUPAC Name | 2-methyl-6H-pyrrolo[2,3-g][1,3]benzoxazole-8-carbonitrile |
| SMILES | Cc1nc2ccc3[nH]cc(C#N)c3c2o1 |
| InChI | InChI=1S/C11H7N3O/c1-6-14-9-3-2-8-10(11(9)15-6)7(4-12)5-13-8/h2-3,5,13H,1H3 |
| InChIKey | SGAUHEHJQPOHEZ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 65.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.20 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-6H-pyrrolo[2,3-g][1,3]benzoxazole-8-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-6H-pyrrolo[2,3-g][1,3]benzoxazole-8-carbonitrile?
The IUPAC name of 2-methyl-6H-pyrrolo[2,3-g][1,3]benzoxazole-8-carbonitrile (CID 178076659) is 2-methyl-6H-pyrrolo[2,3-g][1,3]benzoxazole-8-carbonitrile.
What is the SMILES notation for 2-methyl-6H-pyrrolo[2,3-g][1,3]benzoxazole-8-carbonitrile?
The canonical SMILES for 2-methyl-6H-pyrrolo[2,3-g][1,3]benzoxazole-8-carbonitrile is Cc1nc2ccc3[nH]cc(C#N)c3c2o1.
What is the InChIKey of 2-methyl-6H-pyrrolo[2,3-g][1,3]benzoxazole-8-carbonitrile?
The InChIKey is SGAUHEHJQPOHEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7N3O/c1-6-14-9-3-2-8-10(11(9)15-6)7(4-12)5-13-8/h2-3,5,13H,1H3.
What are the key properties of 2-methyl-6H-pyrrolo[2,3-g][1,3]benzoxazole-8-carbonitrile?
2-methyl-6H-pyrrolo[2,3-g][1,3]benzoxazole-8-carbonitrile has a molecular weight of 197.20 g/mol, XLogP of 2.49, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-6H-pyrrolo[2,3-g][1,3]benzoxazole-8-carbonitrile is sourced from PubChem (CID 178076659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).