C17H27NO3 — CID 178076696
1-[(E)-dec-2-enoyl]-5-propan-2-ylpyrrolidine-2,4-dione (PubChem CID 178076696) has the molecular formula C17H27NO3 and a molecular weight of 293.41 g/mol. Its IUPAC name is 1-[(E)-dec-2-enoyl]-5-propan-2-ylpyrrolidine-2,4-dione.
| Compound Name | 1-[(E)-dec-2-enoyl]-5-propan-2-ylpyrrolidine-2,4-dione |
|---|---|
| PubChem CID | 178076696 |
| Molecular Formula | C17H27NO3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | 1-[(E)-dec-2-enoyl]-5-propan-2-ylpyrrolidine-2,4-dione |
| SMILES | CCCCCCC/C=C/C(=O)N1C(=O)CC(=O)C1C(C)C |
| InChI | InChI=1S/C17H27NO3/c1-4-5-6-7-8-9-10-11-15(20)18-16(21)12-14(19)17(18)13(2)3/h10-11,13,17H,4-9,12H2,1-3H3/b11-10+ |
| InChIKey | BPEUCHGGHZVMDK-ZHACJKMWSA-N |
| XLogP | 3.26 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|