C21H19ClN4O2S — CID 178076913
3-[4-[[5-[(4-chlorophenyl)methyl]-1,3,4-oxadiazol-2-yl]sulfanyl]butyl]quinazolin-4-one (PubChem CID 178076913) has the molecular formula C21H19ClN4O2S and a molecular weight of 426.93 g/mol. Its IUPAC name is 3-[4-[[5-[(4-chlorophenyl)methyl]-1,3,4-oxadiazol-2-yl]sulfanyl]butyl]quinazolin-4-one.
| Compound Name | 3-[4-[[5-[(4-chlorophenyl)methyl]-1,3,4-oxadiazol-2-yl]sulfanyl]butyl]quinazolin-4-one |
|---|---|
| PubChem CID | 178076913 |
| Molecular Formula | C21H19ClN4O2S |
| Molecular Weight | 426.93 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | 3-[4-[[5-[(4-chlorophenyl)methyl]-1,3,4-oxadiazol-2-yl]sulfanyl]butyl]quinazolin-4-one |
| SMILES | O=c1c2ccccc2ncn1CCCCSc1nnc(Cc2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C21H19ClN4O2S/c22-16-9-7-15(8-10-16)13-19-24-25-21(28-19)29-12-4-3-11-26-14-23-18-6-2-1-5-17(18)20(26)27/h1-2,5-10,14H,3-4,11-13H2 |
| InChIKey | YTFMMOUYTFINFX-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 73.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.93 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|