About methyl 3-(1,3-dioxol-2-yl)-4-(morpholine-4-carbonylamino)benzoate
methyl 3-(1,3-dioxol-2-yl)-4-(morpholine-4-carbonylamino)benzoate (PubChem CID 178077116) has the molecular formula C16H18N2O6
and a molecular weight of 334.33 g/mol. Its IUPAC name is methyl 3-(1,3-dioxol-2-yl)-4-(morpholine-4-carbonylamino)benzoate.
Molecular Properties
| Compound Name | methyl 3-(1,3-dioxol-2-yl)-4-(morpholine-4-carbonylamino)benzoate |
| PubChem CID | 178077116 |
| Molecular Formula | C16H18N2O6 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | methyl 3-(1,3-dioxol-2-yl)-4-(morpholine-4-carbonylamino)benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)N2CCOCC2)c(C2OC=CO2)c1 |
| InChI | InChI=1S/C16H18N2O6/c1-21-14(19)11-2-3-13(12(10-11)15-23-8-9-24-15)17-16(20)18-4-6-22-7-5-18/h2-3,8-10,15H,4-7H2,1H3,(H,17,20) |
| InChIKey | QHUDDPHTMPRDNK-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 3-(1,3-dioxol-2-yl)-4-(morpholine-4-carbonylamino)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(1,3-dioxol-2-yl)-4-(morpholine-4-carbonylamino)benzoate?
The IUPAC name of methyl 3-(1,3-dioxol-2-yl)-4-(morpholine-4-carbonylamino)benzoate (CID 178077116) is methyl 3-(1,3-dioxol-2-yl)-4-(morpholine-4-carbonylamino)benzoate.
What is the SMILES notation for methyl 3-(1,3-dioxol-2-yl)-4-(morpholine-4-carbonylamino)benzoate?
The canonical SMILES for methyl 3-(1,3-dioxol-2-yl)-4-(morpholine-4-carbonylamino)benzoate is COC(=O)c1ccc(NC(=O)N2CCOCC2)c(C2OC=CO2)c1.
What is the InChIKey of methyl 3-(1,3-dioxol-2-yl)-4-(morpholine-4-carbonylamino)benzoate?
The InChIKey is QHUDDPHTMPRDNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O6/c1-21-14(19)11-2-3-13(12(10-11)15-23-8-9-24-15)17-16(20)18-4-6-22-7-5-18/h2-3,8-10,15H,4-7H2,1H3,(H,17,20).
What are the key properties of methyl 3-(1,3-dioxol-2-yl)-4-(morpholine-4-carbonylamino)benzoate?
methyl 3-(1,3-dioxol-2-yl)-4-(morpholine-4-carbonylamino)benzoate has a molecular weight of 334.33 g/mol, XLogP of 1.85, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(1,3-dioxol-2-yl)-4-(morpholine-4-carbonylamino)benzoate is sourced from PubChem (CID 178077116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).