C11H17F4NO3 — CID 178078160
5-ethoxy-4-oxo-N-(3,3,4,4-tetrafluorobutyl)pentanamide (PubChem CID 178078160) has the molecular formula C11H17F4NO3 and a molecular weight of 287.25 g/mol. Its IUPAC name is 5-ethoxy-4-oxo-N-(3,3,4,4-tetrafluorobutyl)pentanamide.
| Compound Name | 5-ethoxy-4-oxo-N-(3,3,4,4-tetrafluorobutyl)pentanamide |
|---|---|
| PubChem CID | 178078160 |
| Molecular Formula | C11H17F4NO3 |
| Molecular Weight | 287.25 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 5-ethoxy-4-oxo-N-(3,3,4,4-tetrafluorobutyl)pentanamide |
| SMILES | CCOCC(=O)CCC(=O)NCCC(F)(F)C(F)F |
| InChI | InChI=1S/C11H17F4NO3/c1-2-19-7-8(17)3-4-9(18)16-6-5-11(14,15)10(12)13/h10H,2-7H2,1H3,(H,16,18) |
| InChIKey | YVGUPGUIPICYQD-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.25 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|